| Company Name: |
Henan Weituxi Chemical Technology Co., Ltd.
|
| Tel: |
0371-63284658 18135795563 |
| Email: |
3905209149@qq.com |
| Products Intro: |
Product Name:Coumarin 343 X carboxylic acid
CAS:946123-11-1
Purity:98% Package:100mg;250mg;1000mg
|
| Company Name: |
Nanjing Shizhou Biology Technology Co.,Ltd
|
| Tel: |
025-85563444 18351873721 |
| Email: |
purchase@synzest.com |
| Products Intro: |
Product Name:Coumarin 343 X carboxylic acid
Purity:95%HPLC Package:50mg;100mg;250mg;1g
|
|
| | Coumarin 343 X carboxylic acid Basic information |
| Product Name: | Coumarin 343 X carboxylic acid | | Synonyms: | Coumarin 343 X carboxylic acid;Hexanoic acid, 6-[[(2,3,6,7-tetrahydro-11-oxo-1H,5H,11H-[1]benzopyrano[6,7,8-ij]quinolizin-10-yl)carbonyl]amino]- | | CAS: | 946123-11-1 | | MF: | C22H26N2O5 | | MW: | 398.45 | | EINECS: | | | Product Categories: | | | Mol File: | 946123-11-1.mol |  |
| | Coumarin 343 X carboxylic acid Chemical Properties |
| Boiling point | 761.5±60.0 °C(Predicted) | | density | 1.35±0.1 g/cm3(Predicted) | | solubility | Well soluble in DMF, DMSO, moderately soluble in DCM, DCE, EtOAc, insoluble in diethyl ether. | | pka | 4.74±0.10(Predicted) | | Appearance | yellow crystals | | InChI | InChI=1S/C22H26N2O5/c25-18(26)8-2-1-3-9-23-21(27)17-13-15-12-14-6-4-10-24-11-5-7-16(19(14)24)20(15)29-22(17)28/h12-13H,1-11H2,(H,23,27)(H,25,26) | | InChIKey | HCUGYFCWVUOZRK-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCNC(C1=CC2=CC3=C4C(=C2OC1=O)CCCN4CCC3)=O |
| | Coumarin 343 X carboxylic acid Usage And Synthesis |
| Description | Coumarin 343 is a blue emitting fluorophore used as a laser dye. The fluorophore can serve as a FRET donor for FAM (fluorescein). | | Uses | Coumarin 343 X carboxylic acid is a blue emitting fluorophore used as a laser dye. The fluorophore can serve as a FRET donor for FAM (fluorescein). | | Abs/Em Maxima | 437/477 nm | | Fluoresene quantum yield | 0.63 | | Extinction Coefficient | 39000 | | CF260 | 0.29 | | CF280 | 0.24 |
| | Coumarin 343 X carboxylic acid Preparation Products And Raw materials |
|