| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | TCO-PNB Ester Basic information |
| Product Name: | TCO-PNB Ester | | Synonyms: | TCO-PNB Ester;TCO-PNB ester >=95%;(E)-cyclooct-4-en active ester / TCO4 / A- active ester (p-NPE) / axial;(E)-cyclooct-4-en active ester / TCO/A- active ester (p-NPC) / axial;TCO*E - active ester (p-NPC) / equatorial;(R,E)-Cyclooct-4-en-1-yl (4-nitrophenyl) carbonate;cyclooct-4-en-1-yl] (4-nitrophenyl) carbonate;Carbonic acid, (1R,4E)-4-cycloocten-1-yl 4-nitrophenyl ester | | CAS: | 1438415-89-4 | | MF: | C15H17NO5 | | MW: | 291.3 | | EINECS: | | | Product Categories: | SiChem | | Mol File: | 1438415-89-4.mol |  |
| | TCO-PNB Ester Chemical Properties |
| Boiling point | 433.9±45.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | form | powder or chunks | | color | Off-white to light yellow | | InChI | 1S/C15H17NO5/c17-15(20-13-6-4-2-1-3-5-7-13)21-14-10-8-12(9-11-14)16(18)19/h1-2,8-11,13H,3-7H2 | | InChIKey | FJMMADPCDJNXAH-UHFFFAOYSA-N | | SMILES | O=C(OC1CCC/C=C/CC1)OC2=CC=C([N+]([O-])=O)C=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | TCO-PNB Ester Usage And Synthesis |
| Description | TCO-PNB Ester contains two reactive substituents. The PNB ester is reactive with amine groups. TCO group can participate in Click Chemistry reactions with tetrazine and can be used to label antibodies and proteins. | | Uses | TCO-PNB ester (trans-Cyclooctene-p-nitrobenzyl ester) has a p-nitrobenzyl (PNB) ester group that is amine reactive and a trans-cyclooctene (TCO) group that is reactive with tetrazines. TCO-PNB ester is supplied as a single axial (major) diastereomer. This specially formulated crystalline material provides easy handling and extended shelf life. | | reaction suitability | reaction type: click chemistry
reagent type: cross-linking reagent | | IC 50 | Alkyl/ether |
| | TCO-PNB Ester Preparation Products And Raw materials |
|