| Company Name: |
Bide Pharmatech Ltd. Gold |
| Tel: |
400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
TCO-carbonate manufacturers
- TCO-NHS ester
-
- $38.00
-
2026-07-15
- CAS:1191901-33-3
- Purity: 98.10%
- Supply Ability: 10g
- (4E)-TCO-NHS ester
-
-
2025-06-07
- CAS:1191901-33-3
- Min. Order: 25mg
- Purity: >95.00%
- Supply Ability: 25mg
|
| | TCO-carbonate Basic information |
| Product Name: | TCO-carbonate | | Synonyms: | (E)-4-Cycloocten-1-yl 2,5-dioxo-1-pyrrolidinyl ester carbonic acid;TCO-carbonate;TCO-N-hydroxysuccinimidyl carbonate;trans-4-Cycloocten-1-yl 2,5-dioxo-1-pyrrolidinyl carbonate;TCO4 - NHS carbonate / EQUATORIAL isomer;TCO4 - NHS carbonate / AXIAL isomer;TCO-NHS Ester,Trans-Cyclooctene-NHS ester;Carbonic acid, (4E)-4-cycloocten-1-yl 2,5-dioxo-1-pyrrolidinyl ester | | CAS: | 1191901-33-3 | | MF: | C13H17NO5 | | MW: | 267.28 | | EINECS: | | | Product Categories: | SiChem | | Mol File: | 1191901-33-3.mol |  |
| | TCO-carbonate Chemical Properties |
| Melting point | 90-105°C | | Boiling point | 369.1±45.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C13H17NO5/c15-11-8-9-12(16)14(11)19-13(17)18-10-6-4-2-1-3-5-7-10/h1-2,10H,3-9H2/b2-1+ | | InChIKey | OUGQJOKGFAIFAQ-OWOJBTEDSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)OC1CCCC=CCC1 |t:16| |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | TCO-carbonate Usage And Synthesis |
| Description | TCO-NHS Ester is an popular reagent to label amine-containing compound or biomolecule, TCOI enable fast click chemistry with tetrazine. | | Uses | Succinimidyl carbonate/NHS functionalized cyclooctene derivative for incorporation of the cyclooctene moiety into amine containing compounds or biomolecules. Cyclooctenes are useful in strain-promoted copper-free click chemistry cycloaddition reactions with 1,2,4,5-tetrazines. This cyclooctene will react with tetrazine functionalized compounds or biomolecules without the need for a catalyst to result in a stable covalent linkage. The 4+2 inverse electron demand Diels-Alder cycloaddition between trans-cyclooctene and tetrazines is the fastest biologically compatible ligation technology reported and has had many applications in biological labeling and imaging. | | reaction suitability | reaction type: click chemistry
reagent type: linker | | IC 50 | Alkyl/ether |
| | TCO-carbonate Preparation Products And Raw materials |
|