| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 17beta-Hydroxy-4-androsten-3-one 3-[O-carboxymethyl]oxime Basic information |
| Product Name: | 17beta-Hydroxy-4-androsten-3-one 3-[O-carboxymethyl]oxime | | Synonyms: | TESTOSTERONE 3-CMO;4-ANDROSTEN-17BETA-OL-3-ONE 3-[O-CARBOXYMETHYL]OXIME;testosterone 3-0-carboxymethyloxime *--- dea sche;17β-hydroxy-4-androsten-3-one 3-(o-carboxymethyl)oxime;17β-Hydroxy-4-androsten-3-one 3-(O-carboxymethyl)oxime, 4-Androsten-17β-ol-3-one 3-(O-carboxymethyl)oxime;4-Androsten-17β-ol-3-one 3-(O-carboxymethyl)oxime;Testosterone (carboxymethyl)oxime;Acetic acid, 2-[[[(17β)-17-hydroxyandrost-4-en-3-ylidene]amino]oxy]- | | CAS: | 10190-93-9 | | MF: | C21H31NO4 | | MW: | 361.48 | | EINECS: | | | Product Categories: | | | Mol File: | 10190-93-9.mol | ![17beta-Hydroxy-4-androsten-3-one 3-[O-carboxymethyl]oxime Structure](CAS/GIF/10190-93-9.gif) |
| | 17beta-Hydroxy-4-androsten-3-one 3-[O-carboxymethyl]oxime Chemical Properties |
| Melting point | 179-181 °C | | Boiling point | 526.8±60.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | room temp | | solubility | ethanol: soluble49-51mg/mL, clear, colorless to faintly yellow | | pka | 3.15±0.10(Predicted) | | form | powder | | InChIKey | VDYLVWGBLQNNAW-MIQUVITGNA-N | | SMILES | [C@@]12([H])CCC3=C/C(=N\OCC(=O)O)/CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])O |&1:0,15,17,21,23,26,r| |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2 |
| | 17beta-Hydroxy-4-androsten-3-one 3-[O-carboxymethyl]oxime Usage And Synthesis |
| Uses | Testosterone 3-(O-carboxymethyl)oxime has been used to prepare horseradish peroxidase (HRP)-labeled testosterone to measure plasma testosterone concentration by enzyme immunoassay. | | Biochem/physiol Actions | Androgens direct the development of male reproductive system and secondary sexual characteristics. Testosterone is an androgen that is secreted by the testis. This hormone is converted to dihydrotestosterone (DHT) by 5α reductase in the target tissues. Both DHT and testosterone require androgen receptor, a ligand-dependent nuclear transcription factor to mediate their biological functions. |
| | 17beta-Hydroxy-4-androsten-3-one 3-[O-carboxymethyl]oxime Preparation Products And Raw materials |
|