BENZOYLNITROMETHANE manufacturers
- BENZOYLNITROMETHANE
-
- $1001.00 / 1bag
-
2023-08-31
- CAS:614-21-1
- Min. Order: 1bag
- Purity: 99
- Supply Ability: 5000
|
| | BENZOYLNITROMETHANE Basic information |
| Product Name: | BENZOYLNITROMETHANE | | Synonyms: | Benzoylnitromethane,98%;Benzoylnitromethanealpha-Nitroacetophenone;BenzoylnitroMethane, 98% 5GR;ALPHA-NITROACETOPHENONE;AKOS B022283;BenzoylnitroMethane 98%;BENZOYLNITROMETHANE;Benzoylnitromethane, GC 98% | | CAS: | 614-21-1 | | MF: | C8H7NO3 | | MW: | 165.15 | | EINECS: | | | Product Categories: | | | Mol File: | 614-21-1.mol |  |
| | BENZOYLNITROMETHANE Chemical Properties |
| Melting point | 105-107 °C (lit.) | | Boiling point | 292.97°C (rough estimate) | | density | 1.3450 (rough estimate) | | refractive index | 1.5468 (estimate) | | storage temp. | 2-8°C | | form | Liquid | | pka | 5.37±0.29(Predicted) | | color | Clear colorless or yellow to red to brown | | InChI | 1S/C8H7NO3/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5H,6H2 | | InChIKey | JTWHVBNYYWFXSI-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)CC(=O)c1ccccc1 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29147000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | BENZOYLNITROMETHANE Usage And Synthesis |
| Chemical Properties | white waxy crystalline powder or flakes | | Uses | The kinetics of proton transfer from benzoylnitromethane to various bases was studied. | | General Description | The kinetics of proton transfer from benzoylnitromethane to various bases was studied. |
| | BENZOYLNITROMETHANE Preparation Products And Raw materials |
|