| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Ethyl (2-nitrobenzoyl)acetate Basic information |
| | Ethyl (2-nitrobenzoyl)acetate Chemical Properties |
| Melting point | 30-34 °C(lit.) | | Boiling point | 170 °C(Press: 0.1 Torr) | | density | 1.276±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | Liquid | | pka | 9.42±0.46(Predicted) | | color | Clear orange to brown | | InChI | 1S/C11H11NO5/c1-2-17-11(14)7-10(13)8-5-3-4-6-9(8)12(15)16/h3-6H,2,7H2,1H3 | | InChIKey | OWZNCVIBJQPNEF-UHFFFAOYSA-N | | SMILES | CCOC(=O)CC(=O)c1ccccc1[N+]([O-])=O |
| WGK Germany | 3 | | HS Code | 29183000 | | Storage Class | 11 - Combustible Solids |
| | Ethyl (2-nitrobenzoyl)acetate Usage And Synthesis |
| Uses | Ethyl 2-nitrobenzoylacetate may be used to synthesize ethyl 2-bromo-2′-nitrobenzoylacetate and 4-hydroxy-2(1H)-quinolone. |
| | Ethyl (2-nitrobenzoyl)acetate Preparation Products And Raw materials |
|