- 9-ACETYLANTHRACENE
-
- $1.00
-
2020-01-13
- CAS:784-04-3
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 10000KGS
|
| | 9-Acetylanthracene Basic information |
| | 9-Acetylanthracene Chemical Properties |
| Melting point | 75-76 °C (lit.) | | Boiling point | 321.21°C (rough estimate) | | density | 1.0588 (rough estimate) | | refractive index | 1.5800 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated), Water (Slightly) | | form | Crystalline Powder | | color | Yellow to yellow-brown | | Water Solubility | Insoluble in water. | | BRN | 1370056 | | InChI | InChI=1S/C16H12O/c1-11(17)16-14-8-4-2-6-12(14)10-13-7-3-5-9-15(13)16/h2-10H,1H3 | | InChIKey | NXXNVJDXUHMAHU-UHFFFAOYSA-N | | SMILES | C(=O)(C1C2=CC=CC=C2C=C2C=1C=CC=C2)C | | CAS DataBase Reference | 784-04-3(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29143900 | | Storage Class | 11 - Combustible Solids |
| | 9-Acetylanthracene Usage And Synthesis |
| Chemical Properties | yellow to yellow-brown crystalline powder | | Uses | 9-Acetylanthracene is used in Organic Synthesis, Pharmaceuticals, Agrochemicals and Dyestuffs. | | Uses | 9-Acetylanthracene is used in the synthesis of luminescent moieties such as (9-anthryl)pyrazole (ANP) and 2,2-difluoro-4-(9-anthracyl)-6-methyl-1,3,2-dioxaborine. It is also used as a carrier ligand in the synthesis of fluorescent platinum(II) compounds. | | Purification Methods | Crystallise 9-acetylanthracene from EtOH. [Masnori et al. J Am Chem Soc 108 1126 1986, Beilstein 7 II 450.] |
| | 9-Acetylanthracene Preparation Products And Raw materials |
|