| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:tert-Butyl Methyl-d3 Ether CAS:29366-08-3 Remarks:CS-C-01822
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:tert-Butyl methyl-d3 ether CAS:29366-08-3 Purity:99 atom % D Package:1G Remarks:434132-1G
|
| Company Name: |
Clearsynth Canada Inc.
|
| Tel: |
+1.415.685.4395 |
| Email: |
enquiry@clearsynth.com |
| Products Intro: |
Product Name:Tert-Butyl methyl-D3 ether CAS:29366-08-3 Remarks:CS-BX-00372
|
| Company Name: |
ChengDu SinoStandards Bio-Tech Co.,Ltd. ,
|
| Tel: |
028-83243028 19136088901 |
| Email: |
sinostandards@163.com |
| Products Intro: |
Product Name:tert-Butyl Methyl-d3 Ether CAS:29366-08-3 Purity:标准品 Package:10mg;100mg;1g
|
|
| | TERT-BUTYL METHYL-D3 ETHER Basic information |
| | TERT-BUTYL METHYL-D3 ETHER Chemical Properties |
| Boiling point | 55-56 °C (lit.) | | density | 0.765 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.368(lit.) | | Fp | 14 °F | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) | | form | Liquid | | color | Colourless | | BRN | 2036450 | | Stability: | Volatile | | Major Application | microbiology | | InChI | 1S/C5H12O/c1-5(2,3)6-4/h1-4H3/i4D3 | | InChIKey | BZLVMXJERCGZMT-GKOSEXJESA-N | | SMILES | [2H]C([2H])([2H])OC(C)(C)C | | EPA Substance Registry System | Propane, 2-(methoxy-d3)-2-methyl- (29366-08-3) |
| Hazard Codes | F,Xn,Xi | | Risk Statements | 11-40-43-38 | | Safety Statements | 16-36/37-24-9 | | RIDADR | UN 2398 3/PG 2 | | WGK Germany | 3 | | F | 3-10 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 Skin Irrit. 2 |
| | TERT-BUTYL METHYL-D3 ETHER Usage And Synthesis |
| Uses | tert-Butyl Methyl-d3 Ether was useful for preparing catalytic etherification of alcohols in Shilov system. | | General Description | tert-Butyl methyl-d3 ether is a deuterated NMR solvent useful in NMR-based research and analyses. |
| | TERT-BUTYL METHYL-D3 ETHER Preparation Products And Raw materials |
|