| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Cyclohexyl p-toluenesulfonate Basic information |
| Product Name: | Cyclohexyl p-toluenesulfonate | | Synonyms: | 4-methyl-benzenesulfonicacicyclohexylester;CYCLOHEXYL P-TOLUENESULPHONATE;cyclohexyl p-tosylate;p-toluenesulfonic acid cyclohexyl ester;CYCLOHEXYL 4-TOLUENESULFONATE;4-Methylbenzenesulfonic acid cyclohexyl ester;Cyclohexyl p-toluenesulfonate,99%;p-Toluenesulfonic Acid Cyclohexyl Ester
Cyclohexyl Tosylate | | CAS: | 953-91-3 | | MF: | C13H18O3S | | MW: | 254.35 | | EINECS: | 213-468-8 | | Product Categories: | | | Mol File: | 953-91-3.mol |  |
| | Cyclohexyl p-toluenesulfonate Chemical Properties |
| Melting point | 45-46°C | | Boiling point | 382.1±11.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | BRN | 2217391 | | InChI | InChI=1S/C13H18O3S/c1-11-7-9-13(10-8-11)17(14,15)16-12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3 | | InChIKey | OHHPZPDQZMUTCA-UHFFFAOYSA-N | | SMILES | C1(S(OC2CCCCC2)(=O)=O)=CC=C(C)C=C1 | | EPA Substance Registry System | Benzenesulfonic acid, 4-methyl-, cyclohexyl ester (953-91-3) |
| Provider | Language |
|
ALFA
| English |
| | Cyclohexyl p-toluenesulfonate Usage And Synthesis |
| Chemical Properties | Slightly beige crystalline powder |
| | Cyclohexyl p-toluenesulfonate Preparation Products And Raw materials |
|