| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Wuxi AppTec |
| Tel: |
022-59987777 13552403979 |
| Email: |
jia_guoqiang@wuxiapptec.com |
|
| | (1-Aminomethyl-cyclopentyl)-carbamic acid tert-butyl ester Basic information |
| Product Name: | (1-Aminomethyl-cyclopentyl)-carbamic acid tert-butyl ester | | Synonyms: | 1-(Boc-amino)-1-aminomethyl cyclopentane;1-(Boc-amino)-1-aminomethyl cyclopentane 95%;tert-butyl 1-(aminomethyl)cyclopentylcarbamate;1-(Boc-amino)cyclopentylmethanamine;Carbamic acid, N-[1-(aminomethyl)cyclopentyl]-, 1,1-dimethylethyl ester;tert-butyl N-[1-(aminomethyl)cyclopentyl]carbamate;(1-Aminomethyl-cyclopentyl)-carbamic acid tert-butyl ester | | CAS: | 889949-09-1 | | MF: | C11H22N2O2 | | MW: | 214.31 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 889949-09-1.mol |  |
| | (1-Aminomethyl-cyclopentyl)-carbamic acid tert-butyl ester Chemical Properties |
| Melting point | 72-78 °C | | Boiling point | 320.0±11.0 °C(Predicted) | | density | 1.03±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder | | pka | 12.62±0.20(Predicted) | | InChI | 1S/C11H22N2O2/c1-10(2,3)15-9(14)13-11(8-12)6-4-5-7-11/h4-8,12H2,1-3H3,(H,13,14) | | InChIKey | XEJPADMAPZAZEL-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NC1(CN)CCCC1 |
| Hazard Codes | Xi | | Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | (1-Aminomethyl-cyclopentyl)-carbamic acid tert-butyl ester Usage And Synthesis |
| | (1-Aminomethyl-cyclopentyl)-carbamic acid tert-butyl ester Preparation Products And Raw materials |
|