|
|
| | 3-Cyclopentapyrazolecarboxylic acid, 1,4,5,6-tetrahydro-, ethyl ester Basic information |
| Product Name: | 3-Cyclopentapyrazolecarboxylic acid, 1,4,5,6-tetrahydro-, ethyl ester | | Synonyms: | AKOS PAO-0213;1,4,5,6-Tetrahydro-cyclopentapyrazole-3-carboxylic acid ethyl ester;Ethyl 1,4,5,6-tetrahydrocyclopentapyrazole-3-carboxylate;1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxylic acid ethyl ester;ethyl 1H,4H,5H,6H-cyclopenta[c]pyrazole-3-carboxylate;ethyl 1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxylate;ETHYLCYCLOPENTACPYRAZOLECARBOXYLATE;1,4,5,6-Tetrahydro-3-cyclopentapyrazolecarboxylic acid ethyl ester | | CAS: | 5932-31-0 | | MF: | C9H12N2O2 | | MW: | 180.2 | | EINECS: | | | Product Categories: | | | Mol File: | 5932-31-0.mol |  |
| | 3-Cyclopentapyrazolecarboxylic acid, 1,4,5,6-tetrahydro-, ethyl ester Chemical Properties |
| Melting point | 125 °C | | Boiling point | 384.1±42.0 °C(Predicted) | | density | 1.247±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 12.55±0.20(Predicted) | | color | Yellow | | InChI | InChI=1S/C9H12N2O2/c1-2-13-9(12)8-6-4-3-5-7(6)10-11-8/h2-5H2,1H3,(H,10,11) | | InChIKey | NDGAORNQTOHHSU-UHFFFAOYSA-N | | SMILES | N1=C(C(OCC)=O)C2CCCC=2N1 |
| HazardClass | IRRITANT | | HS Code | 2933199090 |
| | 3-Cyclopentapyrazolecarboxylic acid, 1,4,5,6-tetrahydro-, ethyl ester Usage And Synthesis |
| | 3-Cyclopentapyrazolecarboxylic acid, 1,4,5,6-tetrahydro-, ethyl ester Preparation Products And Raw materials |
|