| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1-Benzyl-3-piperidone hydrochloride Basic information |
| | 1-Benzyl-3-piperidone hydrochloride Chemical Properties |
| Melting point | 170 °C | | Boiling point | 91°C/0.02mmHg(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | color | Cream to pale brown | | BRN | 3705146 | | InChI | 1S/C12H15NO.ClH.H2O/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11;;/h1-3,5-6H,4,7-10H2;1H;1H2 | | InChIKey | XDAGZUGDGORLMZ-UHFFFAOYSA-N | | SMILES | Cl[H].[H]O[H].O=C1CCCN(C1)Cc2ccccc2 | | CAS DataBase Reference | 50606-58-1(CAS DataBase Reference) |
| | 1-Benzyl-3-piperidone hydrochloride Usage And Synthesis |
| Chemical Properties | cream to pale brown powder | | Uses | 1-Benzyl-3-piperidone hydrochloride hydrate was used to prepare 7-Benzyl-3-(phenylthio)-1-oxa-4,7-diazaspiro[4.5]dec-3-en-2-one. | | Synthesis | Piperidone hydrochloride, potassium carbonate, potassium iodide and triethylbenzylammonium chloride, benzyl bromide to the three reaction flask, add water and toluene, reflux, stirring reaction, thin-layer chromatography to detect the endpoints Expanding agent: V (cyclohexane)V (ethyl acetate), the reaction is 11 ~ 12h. cooled to room temperature, separated out the organic layer, toluene to extract the aqueous layer, the combination of the organic layer, saturated sodium bicarbonate solution and water to wash, dry anhydrous sodium sulfate. Dry with anhydrous sodium sulfate, evaporate the toluene, dry to a white solid, the crude product was recrystallized with anhydrous ethanol to obtain a white to off-white powder 1-benzyl-3-piperidone hydrochloride. |
| | 1-Benzyl-3-piperidone hydrochloride Preparation Products And Raw materials |
|