|
|
| | 1,3:2,4-Dibenzylidene sorbitol Basic information |
| Product Name: | 1,3:2,4-Dibenzylidene sorbitol | | Synonyms: | Bis-O-(benzylidene)-D-glucitol;IRGACLEAR D;bis-o-(phenylmethylene)-d-glucito;bis-O-(phenylmethylene)-D-Glucitol;dibenzalsorbitol;1,3:2,4-Dibenzylidene sorbitol;(2R,3R,4R,5S)-Hexane-1,2,3,4,5,6-hexaol compound with phenylmethanediol;sorbitoldibenzol | | CAS: | 32647-67-9 | | MF: | C20H22O6 | | MW: | 358.39 | | EINECS: | 251-136-4 | | Product Categories: | | | Mol File: | 32647-67-9.mol |  |
| | 1,3:2,4-Dibenzylidene sorbitol Chemical Properties |
| Melting point | 224-228°C | | density | 1.272 | | vapor pressure | 0.004Pa at 25℃ | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | 13mg/L at 20℃ | | Cosmetics Ingredients Functions | VISCOSITY CONTROLLING | | InChI | InChI=1/C20H22O6/c21-11-15-17(25-19(23-15)13-7-3-1-4-8-13)18-16(12-22)24-20(26-18)14-9-5-2-6-10-14/h1-10,15-22H,11-12H2/t15-,16+,17-,18-,19,20/s3 | | InChIKey | FRNYWYUVZQQBQN-SXGHDUHSNA-N | | SMILES | [C@@]1([H])(OC(C2=CC=CC=C2)O[C@H]1CO)[C@]1([H])OC(C2=CC=CC=C2)O[C@@H]1CO |&1:0,11,14,25,r| | | LogP | 2.16 at 30℃ | | EPA Substance Registry System | Dibenzylidene sorbitol (32647-67-9) |
| | 1,3:2,4-Dibenzylidene sorbitol Usage And Synthesis |
| Flammability and Explosibility | Not classified |
| | 1,3:2,4-Dibenzylidene sorbitol Preparation Products And Raw materials |
|