| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4Z,7z,10z,13z,16z,19z-docosahexaenoic-21,21,22,22,22-d5 acid Basic information |
| Product Name: | 4Z,7z,10z,13z,16z,19z-docosahexaenoic-21,21,22,22,22-d5 acid | | Synonyms: | DHA-D5;CERVONIC ACID-D5;DOCOSAHEXAENOIC ACID-D5;(all-Z)-4,7,10,13,16,19-Docosahexaenoic Acid-d5;Doconexent-d5;Marinol D 50TG-d5;Ropufa 60-d5;cis-4,7,10,13,16,19-Docosahexaenoic Acid-[21,21,22,22,22-D5] | | CAS: | 1197205-71-2 | | MF: | C22H27D5O2 | | MW: | 333.52 | | EINECS: | | | Product Categories: | Isotope Labelled Compounds;Glycerols, Fatty Acid Derivatives & Lipids, Isotope Labelled Compounds;Fatty Acid Derivatives & Lipids;Glycerols;Isotope Labeled Compounds | | Mol File: | Mol File |  |
| | 4Z,7z,10z,13z,16z,19z-docosahexaenoic-21,21,22,22,22-d5 acid Chemical Properties |
| Boiling point | 446.732±24.00 °C(Press: 760.00 Torr)(predicted) | | density | 0.944±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | 62 °C | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Hexane (Slightly) | | form | Oil | | pka | 4.581±0.10(predicted) | | color | Clear Colourless | | Stability: | Light and Air Sensitive | | InChIKey | MBMBGCFOFBJSGT-RPBOKJFVSA-N | | SMILES | [2H]C([2H])([2H])C([2H])([2H])\C=C/C\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCC(O)=O | | CAS Number Unlabeled | 6217-54-5 |
| RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 4Z,7z,10z,13z,16z,19z-docosahexaenoic-21,21,22,22,22-d5 acid Usage And Synthesis |
| Chemical Properties | Clear Colourless Liquid | | Uses | Omega-3 fatty acid found in marine fish oils and in many phospholipids. Major structural component of excitable membranes of the retina and brain; synthesized in the liver from α-linolenic acid. Nutritional supplement. |
| | 4Z,7z,10z,13z,16z,19z-docosahexaenoic-21,21,22,22,22-d5 acid Preparation Products And Raw materials |
|