| Company Name: |
HBCChem, Inc. |
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
N,N-Diethyl-p-phenylenediamine oxalate manufacturers
|
| | N,N-Diethyl-p-phenylenediamine oxalate Basic information |
| Product Name: | N,N-Diethyl-p-phenylenediamine oxalate | | Synonyms: | 4-AMINO-N,N-DIETHYLANILINE OXALATE;N,N-DIETHYL-1,4-PHENYLENE DIAMINE OXALATE;4-Amino-N,N-diethylaniline oxalate salt;N,N-Diethyl-P-phenylenediamine oxalate salt;N,N-Diethyl-p-phenylenediamine oxalate salt technical, >=90% (T);N,N-Diethyl-p-phenylenediamine oxalate salt(1'1);N,N-Diethyl-p-phenylenediamine oxalate salt | | CAS: | 142439-89-2 | | MF: | C10H16N2.C2H2O4 | | MW: | 254.28 | | EINECS: | 629-307-3 | | Product Categories: | Anilines, Aromatic Amines and Nitro Compounds | | Mol File: | 142439-89-2.mol |  |
| | N,N-Diethyl-p-phenylenediamine oxalate Chemical Properties |
| Melting point | 145-150 °C(lit.) | | storage temp. | 2-8°C | | solubility | 1 M HCl: 50mg/mL, clear to very slightly hazy | | form | powder or crystals | | color | white to yellow | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C10H16N2.C2H2O4/c1-3-12(4-2)10-7-5-9(11)6-8-10;3-1(4)2(5)6/h5-8H,3-4,11H2,1-2H3;(H,3,4)(H,5,6) | | InChIKey | GXSUUFAGHVDMCO-UHFFFAOYSA-N | | SMILES | OC(=O)C(O)=O.CCN(CC)c1ccc(N)cc1 |
| Hazard Codes | Xn | | Risk Statements | 21/22-36 | | Safety Statements | 26-36 | | RIDADR | UN 1673 6.1/PG 3 | | WGK Germany | 3 | | F | 8-10-23 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Eye Irrit. 2 |
| | N,N-Diethyl-p-phenylenediamine oxalate Usage And Synthesis |
| Uses | N, N-diethyl-p-phenylenediamine (DPD) oxalate salt is suitable as an analytical reagent (indicator) to determine the various oxidants on treating water. |
| | N,N-Diethyl-p-phenylenediamine oxalate Preparation Products And Raw materials |
|