| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | 2-(3,4-Epoxycyclohexyl) ethylmethyl dimethoxysilane Basic information |
| Product Name: | 2-(3,4-Epoxycyclohexyl) ethylmethyl dimethoxysilane | | Synonyms: | 2-(4-Epoxycyclohexyl) ethylmethyl dimethoxysilane;7-Oxabicyclo[4.1.0]heptane,3-[2-(dimethoxymethylsilyl)ethyl]-;β-(3,4-epoxycyclohexyl)ethylmethyldimethoxysilane;Dimethoxy-methyl-[2-(7-oxabicyclo[4.1.0]heptan-4-yl)ethyl]silane;(2-(7-Oxabicyclo[4.1.0]Heptan-3-yl)ethyl)dimethoxy(methyl)silane;3-[2-(Dimethoxymethylsilyl)ethyl]-7-oxabicyclo[4.1.0]heptane;2-(3,4-Epoxycyclohexyl) ethylmethyl dimethoxysilane | | CAS: | 97802-57-8 | | MF: | C11H22O3Si | | MW: | 230.38 | | EINECS: | | | Product Categories: | | | Mol File: | 97802-57-8.mol |  |
| | 2-(3,4-Epoxycyclohexyl) ethylmethyl dimethoxysilane Chemical Properties |
| Boiling point | 256.0±13.0 °C(Predicted) | | density | 0.993±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C11H22O3Si/c1-12-11(13-2)15-6-5-8-3-4-9-10(7-8)14-9/h8-11H,3-7,15H2,1-2H3 | | InChIKey | ILUPJTSXINZBRU-UHFFFAOYSA-N | | SMILES | C12C(O1)CCC(CC[SiH2]C(OC)OC)C2 |
| | 2-(3,4-Epoxycyclohexyl) ethylmethyl dimethoxysilane Usage And Synthesis |
| | 2-(3,4-Epoxycyclohexyl) ethylmethyl dimethoxysilane Preparation Products And Raw materials |
|