| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | N-METHYLACETAMIDE-D7 Basic information |
| | N-METHYLACETAMIDE-D7 Chemical Properties |
| Melting point | 26-28 °C (lit.) | | Boiling point | 204-206 °C (lit.) | | density | 1.05 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.429(lit.) | | Fp | 108 °C | | InChI | 1S/C3H7NO/c1-3(5)4-2/h1-2H3,(H,4,5)/i1D3,2D3/hD | | InChIKey | OHLUUHNLEMFGTQ-KBKLHOFPSA-N | | SMILES | [2H]N(C(=O)C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Hazard Codes | T | | Risk Statements | 61-36/37/38 | | Safety Statements | 53-26-36/37/39-45 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B |
| | N-METHYLACETAMIDE-D7 Usage And Synthesis |
| Uses | N-Methylacetamide-d7 (CAS# 3669-74-7) is a useful isotopically labeled research compound. |
| | N-METHYLACETAMIDE-D7 Preparation Products And Raw materials |
|