| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | 1,4-Dibromobenzene (13C6) Basic information |
| Product Name: | 1,4-Dibromobenzene (13C6) | | Synonyms: | 1,4-DIBROMOBENZENE (13C6, 99%) 100 UG/ML IN TOLUENE;1,4-Dibromobenzene-13C6;1,4-Dibromobenzene (13C?, 99%);1,4-Dibromobenzene (13C?, 99%) 100 μg/mL in toluene;1,4-Dibromobenzene (13C6) | | CAS: | 201595-52-0 | | MF: | C6H4Br2 | | MW: | 241.96 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 1,4-Dibromobenzene (13C6) Chemical Properties |
| form | solid | | InChI | 1S/C6H4Br2/c7-5-1-2-6(8)4-3-5/h1-4H/i1+1,2+1,3+1,4+1,5+1,6+1 | | InChIKey | SWJPEBQEEAHIGZ-IDEBNGHGSA-N | | SMILES | Br[13c]1[13cH][13cH][13c](Br)[13cH][13cH]1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,4-Dibromobenzene (13C6) Usage And Synthesis |
| | 1,4-Dibromobenzene (13C6) Preparation Products And Raw materials |
|