| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedionato)silver Basic information |
| Product Name: | (6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedionato)silver | | Synonyms: | AG(FOD);SILVER I 6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL-3,5-OCTANEDIONATE;SILVER(I)-FOD;RESOLVE-AL(TM) AGFOD;6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIMETHYL*3 ,5-OCTANEDI;(6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIME.-3,5 -OCTANEDION.)SILVER;RESOLVE-AL AGFOD, 99%;(6,6,7,7,8,8,8-HEPTAFLUORO-2,2-DIME.-3,5 -OCTANEDION.)SILVER 98+% | | CAS: | 76121-99-8 | | MF: | C10H10AgF7O2 | | MW: | 403.05 | | EINECS: | | | Product Categories: | | | Mol File: | 76121-99-8.mol |  |
| | (6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedionato)silver Chemical Properties |
| Melting point | 160 °C (dec.)(lit.) | | form | Fine Crystalline Powder | | color | Green-brown to brown | | InChI | 1S/C10H11F7O2.Ag/c1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17;/h4,18H,1-3H3;/q;+1/p-1/b5-4-; | | InChIKey | HBFPETJZCPEQFV-MKWAYWHRSA-M | | SMILES | CC(C)(C)\C(O[Ag])=C\C(=O)C(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | Silver, (6,6,7,7,8,8,8-heptafluoro-2,2-dimethyl-3,5-octanedionato-?O3,?O5)- (76121-99-8) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | F | 3-8-10-23 | | TSCA | No | | HS Code | 29310099 | | Storage Class | 11 - Combustible Solids |
| | (6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedionato)silver Usage And Synthesis |
| Chemical Properties | GREEN-BROWN TO BROWN FINE CRYSTALLINE POWDER | | Uses | When used in conjunction with a lanthanide shift reagent, provides an efficient NMR shift reagent for aromatic compounds, ammonium salts, and sulfonium and isothiouronium halides. |
| | (6,6,7,7,8,8,8-Heptafluoro-2,2-dimethyl-3,5-octanedionato)silver Preparation Products And Raw materials |
|