| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Biphenylcarboxylic acid hydrazide Basic information |
| Product Name: | 4-Biphenylcarboxylic acid hydrazide | | Synonyms: | AKOS 213-158;4-PHENYLBENZHYDRAZIDE;4-PHENYLBENZOYL HYDRAZINE;4-BIPHENYLCARBONIC ACID HYDRAZID;P-PHENYL BENZHYDRAZIDE;[1,1'-Biphenyl]-4-carbohydrazide;[1,1'-Biphenyl]-4-carboxylic acid, hydrazide;1,1'-Bbiphenyl-4-carboxylic acid, hydrazide | | CAS: | 18622-23-6 | | MF: | C13H12N2O | | MW: | 212.25 | | EINECS: | 242-451-8 | | Product Categories: | Biphenyl derivatives | | Mol File: | 18622-23-6.mol |  |
| | 4-Biphenylcarboxylic acid hydrazide Chemical Properties |
| Melting point | 190-193°C | | density | 1.164±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 12.55±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 1106894 | | InChI | InChI=1S/C13H12N2O/c14-15-13(16)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,14H2,(H,15,16) | | InChIKey | QEUAQXSDDNDOTG-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=C(C(NN)=O)C=C1 | | CAS DataBase Reference | 18622-23-6(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36 | | WGK Germany | WGK 3 | | HS Code | 2928.00.2500 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | 4-Biphenylcarboxylic acid hydrazide Usage And Synthesis |
| | 4-Biphenylcarboxylic acid hydrazide Preparation Products And Raw materials |
|