| Company Name: |
Accela ChemBio Inc. |
| Tel: |
+1-858-6993322 +86-18019713315 |
| Email: |
info@accelachem.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | 1,1,1-Trifluoro-3-phenylpropan-2-ol Basic information |
| Product Name: | 1,1,1-Trifluoro-3-phenylpropan-2-ol | | Synonyms: | (+/-)-α-(trifluoromethyl)benzeneethanol;Benzeneethanol, α-(trifluoromethyl)-;1,1,1-Trifluoro-3-phenyl-2-propanol;1,1,1-Trifluoro-3-phenylpropan-2-ol | | CAS: | 330-72-3 | | MF: | C9H9F3O | | MW: | 190.16 | | EINECS: | | | Product Categories: | | | Mol File: | 330-72-3.mol |  |
| | 1,1,1-Trifluoro-3-phenylpropan-2-ol Chemical Properties |
| Boiling point | 204-204.5 °C(Press: 740 Torr) | | density | 1.242±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 12.46±0.20(Predicted) | | InChI | InChI=1S/C9H9F3O/c10-9(11,12)8(13)6-7-4-2-1-3-5-7/h1-5,8,13H,6H2 | | InChIKey | UPFLNTYTTUCHQN-UHFFFAOYSA-N | | SMILES | C1(C=CC=CC=1)CC(O)C(F)(F)F |
| | 1,1,1-Trifluoro-3-phenylpropan-2-ol Usage And Synthesis |
| | 1,1,1-Trifluoro-3-phenylpropan-2-ol Preparation Products And Raw materials |
|