| Company Name: |
Shanghai Chiral Chemistry Co.,Ltd Gold
|
| Tel: |
021-34621844 17301717660 |
| Email: |
404352994@qq.com |
| Products Intro: |
Product Name:1,1,1-trifluoro-3-phenylpropan-2-ol
CAS:330-72-3
Purity:97% Package:100g
|
| Company Name: |
Santai Labs, Inc.
|
| Tel: |
519-85601385 |
| Email: |
marketing@santailabs.com |
| Products Intro: |
Product Name:1,1,1-TRIFLUORO-3-PHENYLPROPAN-2-OL
CAS:330-72-3
Purity:97% HPLC Package:25G;100G;1kg;25kg
|
| Company Name: |
Zhuhai Aobokai Biomedical Technology Co., Ltd.
|
| Tel: |
400-0628126 |
| Email: |
sales@aobchem.com.cn |
| Products Intro: |
Product Name:1,1,1-trifluoro-3-phenylpropan-2-ol
CAS:330-72-3
Purity:>=95% Package:798元/1g;2396元/5g Remarks:891138
|
|
| | 1,1,1-TRIFLUORO-3-PHENYLPROPAN-2-OL Basic information |
| Product Name: | 1,1,1-TRIFLUORO-3-PHENYLPROPAN-2-OL | | Synonyms: | 1,1,1-TRIFLUORO-3-PHENYLPROPAN-2-OL;(+/-)-α-(trifluoromethyl)benzeneethanol;Benzeneethanol, α-(trifluoromethyl)-;1,1,1-Trifluoro-3-phenyl-2-propanol | | CAS: | 330-72-3 | | MF: | C9H9F3O | | MW: | 190.16 | | EINECS: | | | Product Categories: | | | Mol File: | 330-72-3.mol |  |
| | 1,1,1-TRIFLUORO-3-PHENYLPROPAN-2-OL Chemical Properties |
| Boiling point | 204-204.5 °C(Press: 740 Torr) | | density | 1.242±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 12.46±0.20(Predicted) | | InChI | InChI=1S/C9H9F3O/c10-9(11,12)8(13)6-7-4-2-1-3-5-7/h1-5,8,13H,6H2 | | InChIKey | UPFLNTYTTUCHQN-UHFFFAOYSA-N | | SMILES | C1(C=CC=CC=1)CC(O)C(F)(F)F |
| | 1,1,1-TRIFLUORO-3-PHENYLPROPAN-2-OL Usage And Synthesis |
| | 1,1,1-TRIFLUORO-3-PHENYLPROPAN-2-OL Preparation Products And Raw materials |
|