| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
- POLYBUTENES
-
-
2026-06-30
- CAS:9003-29-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
|
| | POLYBUTENES Basic information |
| | POLYBUTENES Chemical Properties |
| Melting point | 94.3-104.8 °C | | Boiling point | 293-341 °C | | density | 0.908 g/mL at 25 °C | | vapor pressure | 19.7hPa at 20℃ | | refractive index | n20/D 1.504 | | Fp | >230 °F | | storage temp. | -196°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Thick Oil | | color | Colourless | | biological source | Porcine blood | | Dielectric constant | 2.2(Ambient) | | Cosmetics Ingredients Functions | VISCOSITY CONTROLLING
BINDING | | InChI | InChI=1S/2C4H8/c2*1-3-4-2/h3-4H,1-2H3;3H,1,4H2,2H3/b4-3+; | | InChIKey | WTOOLIQYCQJDBG-BJILWQEISA-N | | SMILES | C([H])([H])(C([H])=C([H])[H])C([H])([H])[H].C(/[H])(\C([H])([H])[H])=C(\[H])/C([H])([H])[H] | | EPA Substance Registry System | Polybutene (9003-29-6) |
| WGK Germany | 1 | | RTECS | EM9032000 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Asp. Tox. 1
Skin Irrit. 2 | | Hazardous Substances Data | 9003-29-6(Hazardous Substances Data) |
| | POLYBUTENES Usage And Synthesis |
| Chemical Properties | Polybutylene is composed of linear chains having an isotactic arrangement of ethyl side groups along the chain backbone.
It has a helical conformation in the stable crystalline form.
Polybutylene exhibits high tear, impact, and puncture resistance. It also has low creep, excellent chemical resistance, and abrasion resistance with coilability. | | Uses | Polybutenes is a hydrophobic material that is derivatized to make anti-rust additives and detergents.. | | Uses | Hydrophobic material is derivatized to make detergents and anti-rust additives. Adds tack, flexibility and water repellency to adhesives and coatings. Contributes ′cling′ to LLDPE films. Plasticizer for polymers, lubricants and metal-working fluids. | | Production Methods | Polybutene is commercially produced via cationic polymerisation of isobutylene and other butene isomers. The process typically uses aluminium chloride or boron trifluoride as catalysts under low-temperature conditions to control molecular weight and polymer structure. | | Mechanism of action | Physical - substance is sticky | | Pesticide Type | Repellent; Rodenticide |
| | POLYBUTENES Preparation Products And Raw materials |
|