| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-Chlorobenzoin Basic information |
| Product Name: | 4-Chlorobenzoin | | Synonyms: | 1-(4-CHLOROPHENYL)-2-HYDROXY-2-PHENYLETHANONE;4-Chlorobenzoin,1-(4-Chlorophenyl)-2-hydroxy-2-phenylethanone;Ethanone, 1-(4-chlorophenyl)-2-hydroxy-2-phenyl-;2-(4-Chlorophenyl)-2-hydroxy-1-phenylethan-1-one;4-Chlorobenzoin | | CAS: | 39774-18-0 | | MF: | C14H11ClO2 | | MW: | 246.69 | | EINECS: | | | Product Categories: | | | Mol File: | 39774-18-0.mol |  |
| | 4-Chlorobenzoin Chemical Properties |
| Melting point | 89-93 °C(lit.) | | Boiling point | 407.1±30.0 °C(Predicted) | | density | 1.285±0.06 g/cm3(Predicted) | | pka | 11.82±0.20(Predicted) | | form | solid | | InChI | 1S/C14H11ClO2/c15-12-8-6-11(7-9-12)14(17)13(16)10-4-2-1-3-5-10/h1-9,13,16H | | InChIKey | XYUKKJIDPMMCMJ-UHFFFAOYSA-N | | SMILES | OC(c1ccccc1)C(=O)c2ccc(Cl)cc2 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-Chlorobenzoin Usage And Synthesis |
| | 4-Chlorobenzoin Preparation Products And Raw materials |
|