| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
1,1,1-Trimethyl-N-(triphenylphosphoranylidene)silanamine manufacturers
|
| | 1,1,1-Trimethyl-N-(triphenylphosphoranylidene)silanamine Basic information |
| Product Name: | 1,1,1-Trimethyl-N-(triphenylphosphoranylidene)silanamine | | Synonyms: | Phosphine imide, P,P,P-triphenyl-N-(trimethylsilyl)-;Silanamine, 1,1,1-trimethyl-N-(triphenylphosphoranylidene)-;Triphenyl-N-(trimethylsilyl)phosphine imide;1,1,1-trimethyl-N-(triphenylphosphoranyl-idene)si;triphenyl(trimethylsilylimino)-$l^{5}-phosphane;N-(Trimethylsilyl)-P,P,P-triphenylphosphine imide;N-(Trimethylsilyl)triphenylphosphine imide;N-Trimethylsilyliminotriphenylphosphorane | | CAS: | 13892-06-3 | | MF: | C21H24NPSi | | MW: | 349.48 | | EINECS: | | | Product Categories: | Organic Building Blocks;Others;Phosphorus Compounds | | Mol File: | 13892-06-3.mol |  |
| | 1,1,1-Trimethyl-N-(triphenylphosphoranylidene)silanamine Chemical Properties |
| Melting point | 76-82 °C (lit.) | | Boiling point | 170-171 °C(Press: 0.06 Torr) | | density | 1.00±0.1 g/cm3(Predicted) | | form | solid | | InChI | 1S/C21H24NPSi/c1-24(2,3)22-23(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,1-3H3 | | InChIKey | YTKOPFGRNPVCPE-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)N=P(c1ccccc1)(c2ccccc2)c3ccccc3 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 1,1,1-Trimethyl-N-(triphenylphosphoranylidene)silanamine Usage And Synthesis |
| Uses | 1,1,1-Trimethyl-N-(triphenylphosphoranylidene)silanamine is a reagent used in the synthesis of febrifugine derivatives and in the development of effective and safer tetrahydroquinazoline-type antimalarial. | | General Description | 1,1,1-Trimethyl-N-(triphenylphosphoranylidene)silanamine is an organic building block. |
| | 1,1,1-Trimethyl-N-(triphenylphosphoranylidene)silanamine Preparation Products And Raw materials |
|