| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Di-Boc-cystamine manufacturers
- DI-BOC-CYSTAMINE
-
- $1.00
-
2019-12-26
- CAS:67385-10-8
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 200kg
|
| | Di-Boc-cystamine Basic information |
| Product Name: | Di-Boc-cystamine | | Synonyms: | N,N'-BIS-T-BUTOXYCARBONYL-CYSTAMINE;BIS-BOC-CYSTAMINE;(BOC-NH-ETS)2;IFLAB-BB F2108-0061;1-(2-{[(tert-butoxy)carbonyl]aMino}ethyl)-1-[N-(tert-butoxy)forMaMido]-2-ethyl-1$l^{4}-disulfan-1-yl;Di-tert-Butyl (disulfanediylbis-(ethane-2,1-diyl))dicarbamate;di-Boc-cystamine >=98.0% (TLC);Di-Boc-cystamine≥ 98% (TLC) | | CAS: | 67385-10-8 | | MF: | C14H28N2O4S2 | | MW: | 352.51 | | EINECS: | | | Product Categories: | Miscellaneous Biochemicals | | Mol File: | 67385-10-8.mol |  |
| | Di-Boc-cystamine Chemical Properties |
| Melting point | 120-122 °C | | Boiling point | 477.2±30.0 °C(Predicted) | | density | 1.128±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.90±0.46(Predicted) | | form | solid | | Appearance | White to off-white Solid | | BRN | 4261397 | | InChI | 1S/C14H28N2O4S2/c1-13(2,3)19-11(17)15-7-9-21-22-10-8-16-12(18)20-14(4,5)6/h7-10H2,1-6H3,(H,15,17)(H,16,18) | | InChIKey | HBTMWZADMHBLMY-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NCCSSCCNC(=O)OC(C)(C)C |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Di-Boc-cystamine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Building block for the synthesis of thioethyl-modified peptides | | reaction suitability | reagent type: cross-linking reagent |
| | Di-Boc-cystamine Preparation Products And Raw materials |
|