| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Allyltriphenyltin Basic information |
| | Allyltriphenyltin Chemical Properties |
| Melting point | 71-74 °C(lit.) | | Boiling point | 421.4±38.0 °C(Predicted) | | density | 1,07 g/cm3 | | Fp | >100 | | Water Solubility | Insoluble in water | | form | solid | | color | White to Almost white | | Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | | BRN | 3612762 | | InChI | 1S/3C6H5.C3H5.Sn/c3*1-2-4-6-5-3-1;1-3-2;/h3*1-5H;3H,1-2H2; | | InChIKey | NDUYAGLANMHJHF-UHFFFAOYSA-N | | SMILES | C=CC[Sn](c1ccccc1)(c2ccccc2)c3ccccc3 | | CAS DataBase Reference | 76-63-1(CAS DataBase Reference) |
| Hazard Codes | T,N | | Risk Statements | 23/24/25-50/53 | | Safety Statements | 26-27-28-45-60-61 | | RIDADR | UN 3146 6.1/PG 3 | | WGK Germany | 3 | | RTECS | WH6705000 | | TSCA | No | | HS Code | 2931.90.6000 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| | Allyltriphenyltin Usage And Synthesis |
| Chemical Properties | Needle-like crystals from alc.Sol in most org solvs. | | Uses | Allyltriphenylstannane can be used:
- As a reagent in the C-H phenylation of azoles catalyzed by palladium.
- As an allylating reagent in the alkylidene Meldrum′s acids allylation catalyzed by Sc(OTf)3.
- As a reagent in the total synthesis of an antifungal molecule (+)-ambruticin S.
| | Uses | Allyltriphenyltin is an insect chemosterilants. | | General Description | Allyltriphenylstannane is an organotin compound, which is generally used as allylating and radical chain transfer reagent. It is also used as a source of allyl radicals. | | Hazard | A poison. |
| | Allyltriphenyltin Preparation Products And Raw materials |
|