| Company Name: |
iBioMat Gold |
| Tel: |
88690234 19106834332 |
| Email: |
ibmt@ibiomat.com.cn |
|
| | POLY(D,L-LACTIDE-CO-GLYCOLIDE) Basic information |
| | POLY(D,L-LACTIDE-CO-GLYCOLIDE) Chemical Properties |
| Melting point | 165.09 °C | | density | 1.34 g/cm³ (membranes) | | Fp | 113℃ | | storage temp. | 2-8°C | | solubility | ethyl acetate, chloroform, acetone and THF: soluble | | form | Crystalline Powder or Granules | | color | White to tan | | InChI | InChI=1S/C6H8O4.C4H4O4/c1-3-5(7)10-4(2)6(8)9-3;5-3-1-7-4(6)2-8-3/h3-4H,1-2H3;1-2H2 | | InChIKey | LCSKNASZPVZHEG-UHFFFAOYSA-N | | SMILES | CC1OC(=O)C(C)OC1=O.O=C1OCC(=O)OC1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | POLY(D,L-LACTIDE-CO-GLYCOLIDE) Usage And Synthesis |
| Chemical Properties | intrinsic viscosity 0.15-0.25 | | Uses | Poly(D,L-lactide), Resomer R203s is a copolymer of 1,4-Dioxane-2,5-dione (D485883) and DL-Lactide (L113518). Because the copolymer is biocompatible and biodegradable it is used for controlled release of drugs and therapeutic agents. | | Uses | Poly(D,L-lactide-co-glycolide) is a synthetic amino acid that has been used to deliver macromolecular therapeutics. | | Brand name | Vicryl (Ethicon). | | General Description | Ester terminated Poly(D,L-lactide) (PDLLA, RESOMER ) is a copolymer of L and D-lactic acid and (or L and D lactide). The structure is highly irregular and amorphous. RESOMER polymers are bioresorbable aliphatic polyesters comprised of a range of different ratios of lactide and glycolide monomers, PLA stereochemistries, and end-group functionalization. |
| | POLY(D,L-LACTIDE-CO-GLYCOLIDE) Preparation Products And Raw materials |
|