| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Phenylethynyltri-n-butyltin Basic information |
| | Phenylethynyltri-n-butyltin Chemical Properties |
| density | 1.116 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.532(lit.) | | Fp | >230 °F | | storage temp. | Storage temp. -20°C | | form | liquid | | Specific Gravity | 1.116 | | Appearance | Colorless to light yellow Liquid | | Hydrolytic Sensitivity | 2: reacts with aqueous acid | | InChI | 1S/C8H5.3C4H9.Sn/c1-2-8-6-4-3-5-7-8;3*1-3-4-2;/h3-7H;3*1,3-4H2,2H3; | | InChIKey | PYMPTRMDPJYTDF-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)C#Cc1ccccc1 |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 35-36/37/39-45-60-61 | | RIDADR | UN 2788 6.1/PG 3 | | WGK Germany | 3 | | TSCA | No | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | Phenylethynyltri-n-butyltin Usage And Synthesis |
| Uses | Tributyl(phenylethynyl)tin can be used:
- As a substrate in the palladium-catalyzed homocoupling oforganostannanes to yield biaryl compounds.
- To prepare various enynals, which are employed in the synthesis of substituted benzene derivatives catalyzed by nickel.
- In one of the key synthetic steps for the preparation of β-alkynylcorroles.
|
| | Phenylethynyltri-n-butyltin Preparation Products And Raw materials |
|