| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | trans-2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)styrene Basic information |
| Product Name: | trans-2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)styrene | | Synonyms: | E-Styrylboronic acid pinacol ester;BETA-STYRYLBORONIC ACID PINACOL ESTER;TRANS-STYRYLBORONIC ACID, PINACOL ESTER;trans-2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-;trans-2-Styreneboronic acid pinacol ester, trans-2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)styrene;trans-^b-Styrylboronic acid pinacol ester, 99%;trans-beta-Styrylboronic acid pinacol ester, 99%;trans-2-Styreneboronic acid pinacol ester | | CAS: | 83947-56-2 | | MF: | C14H19BO2 | | MW: | 230.11 | | EINECS: | | | Product Categories: | | | Mol File: | 83947-56-2.mol |  |
| | trans-2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)styrene Chemical Properties |
| Melting point | 27-33 °C(lit.) | | Boiling point | 128°C/4mm | | density | 0.99±0.1 g/cm3(Predicted) | | refractive index | 1.5290 | | Fp | >230 °F | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | Liquid | | color | Clear colorless to pale yellow | | BRN | 8617179 | | InChI | InChI=1S/C14H19BO2/c1-13(2)14(3,4)17-15(16-13)11-10-12-8-6-5-7-9-12/h5-11H,1-4H3/b11-10+ | | InChIKey | ARAINKADEARZLZ-ZHACJKMWSA-N | | SMILES | O1C(C)(C)C(C)(C)OB1/C=C/C1=CC=CC=C1 | | CAS DataBase Reference | 83947-56-2(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29310099 | | Storage Class | 10 - Combustible liquids |
| | trans-2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)styrene Usage And Synthesis |
| Uses | Reactant for:
- Oxidative coupling reactions catalyzed by areneruthenium
- Cycloaddition reactions
- Preparation of allyl vinyl ethers via Cu-catalyzed coupling with alcohols
- Preparation of 5-vinyl-3-pyridinecarbonitriles as PKCθ inhibitors
- Diastereoselective addition to zincated hydrazones and stereospecific trapping of boron/zinc bimetallic intermediates by carbon electrophiles
- Regioselective and stereoselective Pd-catalyzed chelate-controlled intermolecular oxidative Heck reactions
|
| | trans-2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)styrene Preparation Products And Raw materials |
| Raw materials | 1-Phenylvinylboronic acid pinacol ester-->(Z)-4,4,5,5-tetramethyl-2-styryl-1,3,2-dioxaborolane-->Phenylacetylene-->Pinacolborane-->Bis(pinacolato)diboron | | Preparation Products | E-Phenylethenylboronic acid-->1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-phenylcyclopropyl)- |
|