| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | 4-Bromo-1,5-dimethyl-1H-1,2,3-triazole Basic information |
| Product Name: | 4-Bromo-1,5-dimethyl-1H-1,2,3-triazole | | Synonyms: | TOSLAB 805148;1H-1,2,3-Triazole, 4-bromo-1,5-dimethyl-;4-Bromo-1,5-dimethyl-1H-1,2,3-triazole | | CAS: | 885877-41-8 | | MF: | C4H6BrN3 | | MW: | 176.01 | | EINECS: | | | Product Categories: | | | Mol File: | 885877-41-8.mol |  |
| | 4-Bromo-1,5-dimethyl-1H-1,2,3-triazole Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C4H6BrN3/c1-3-4(5)6-7-8(3)2/h1-2H3 | | InChIKey | TYLRPDYYHMFCFT-UHFFFAOYSA-N | | SMILES | N1(C)C(C)=C(Br)N=N1 |
| | 4-Bromo-1,5-dimethyl-1H-1,2,3-triazole Usage And Synthesis |
| | 4-Bromo-1,5-dimethyl-1H-1,2,3-triazole Preparation Products And Raw materials |
|