|
|
| | Hyodeoxycholic acid methyl ester Basic information |
| Product Name: | Hyodeoxycholic acid methyl ester | | Synonyms: | 3,6-dihydroxy-,methylester,(3alpha,5beta,6alpha)-cholan-24-oicaci;METHYL HYODEOXYCHOLATE;5-BETA-CHOLANIC ACID-3-ALPHA, 6-ALPHA-DIOL METHYL ESTER;3ALPHA,6ALPHA-DIHYDROXY-5BETA-CHOLAN-24-OIC ACID METHYL ESTER;3α,6α-Dihydroxy-5β-cholan-24-oic acid methyl ester;3α,6α-Diol-5β-24-cholanoic acid methyl ester;Hyodesoxycholic acid methyl ester;(4R)-Methyl 4-((3R,5R,6S,10R,13R,17R)-3,6-dihydroxy-10,13-diMethylhexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate | | CAS: | 2868-48-6 | | MF: | C25H42O4 | | MW: | 406.6 | | EINECS: | | | Product Categories: | Bile Acids;Biochemistry;Steroids | | Mol File: | 2868-48-6.mol |  |
| | Hyodeoxycholic acid methyl ester Chemical Properties |
| Melting point | 86 °C | | Boiling point | 507.6±25.0 °C(Predicted) | | density | 1.089±0.06 g/cm3(Predicted) | | refractive index | 8 ° (C=1, EtOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.79±0.70(Predicted) | | color | White to Off-White | | InChIKey | BWDRDVHYVJQWBO-QWXHOCAMSA-N | | SMILES | [H][C@@]1(CC[C@@]2([H])[C@]3([H])C[C@H](O)[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC(=O)OC |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Hyodeoxycholic acid methyl ester Usage And Synthesis |
| Chemical Properties | Light Yellow Solid | | Uses | Inhibits the oxidation of cholesterol. A cholesterol derivative with hemolytic properties. |
| | Hyodeoxycholic acid methyl ester Preparation Products And Raw materials |
|