| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:H-Ile-βNA
CAS:732-84-3
Purity:98% Remarks:A01247
|
| Company Name: |
Chemsky（shanghai）International Co.,Ltd.
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:L-Isoleucine b-naphthylaMide
CAS:732-84-3
Purity:98%+ Package:1500RMB/250MG; 1800RMB/500MG; 1900RMB/1G
|
|
| | H-ILE-BETANA Basic information |
| | H-ILE-BETANA Chemical Properties |
| storage temp. | 2-8°C | | form | powder | | color | white to off-white | | InChI | 1S/C16H20N2O/c1-3-11(2)15(17)16(19)18-14-9-8-12-6-4-5-7-13(12)10-14/h4-11,15H,3,17H2,1-2H3,(H,18,19)/t11-,15-/m0/s1 | | InChIKey | CEZPKIGJZWWHJT-NHYWBVRUSA-N | | SMILES | CC[C@H](C)[C@H](N)C(=O)Nc1ccc2ccccc2c1 |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | H-ILE-BETANA Usage And Synthesis |
| Definition | ChEBI: L-isoleucine 2-naphthylamide is an L-isoleucine derivative that is the amide obtained by formal condensation of the carboxy group of L-isoleucine with the amino group of 2-naphthylamine. It has a role as a chromogenic compound. It is a N-(2-naphthyl)carboxamide, an amino acid amide and a L-isoleucine derivative. |
| | H-ILE-BETANA Preparation Products And Raw materials |
|