|
|
| | (Methoxymethyl)triphenylphosphonium chloride Basic information |
| Product Name: | (Methoxymethyl)triphenylphosphonium chloride | | Synonyms: | MMC;AURORA KA-1153;(METHOXYMETHYL)TRIPHENYLPHOSPHONIUM CHLORIDE;METHOXYMETHYL-TRIPHENYLPHOSPHONIUM-;[1aS-(1aa,8b,8aa,8ba)-6-Amino-8-[[(aminocarbonyl)oxy]methyl]-1,1a,2,8,8a,8b-hexahydro-8a-methoxy-5-methylazirino[2,3,4]pyrrolo[1,2-a]indole-4,7-dione;Phosphonium, (methoxymethyl)triphenyl-, chloride;METHOXY METHYL TRIPHENYL PHOSPHONIUM CHLORIDE LOW WATER;(METHOXYMETHYL)TRIPHENYLPHOSPHONIUM CHLORIDE, 98+% | | CAS: | 4009-98-7 | | MF: | C20H20ClOP | | MW: | 342.8 | | EINECS: | 223-664-5 | | Product Categories: | Phosphonium Compounds;Synthetic Organic Chemistry;Wittig & Horner-Emmons Reaction;Wittig Reaction;C-C Bond Formation;Olefination;Wittig Reagents | | Mol File: | 4009-98-7.mol |  |
| | (Methoxymethyl)triphenylphosphonium chloride Chemical Properties |
| Melting point | 185-195 °C (dec.)(lit.) | | bulk density | 450-500kg/m3 | | vapor pressure | <1 hPa ( 20 °C) | | Fp | >250°C | | storage temp. | Store below +30°C. | | solubility | >1100g/l soluble,(decomposition) | | form | Crystalline Powder | | color | White to almost white | | PH | 2.2 (1100g/l, H2O, 20℃) | | Water Solubility | decomposes | | Sensitive | Hygroscopic | | BRN | 924215 | | InChI | 1S/C20H20OP.ClH/c1-21-17-22(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;/h2-16H,17H2,1H3;1H/q+1;/p-1 | | InChIKey | SJFNDMHZXCUXSA-UHFFFAOYSA-M | | SMILES | [Cl-].COC[P+](c1ccccc1)(c2ccccc2)c3ccccc3 | | LogP | -1.17 | | CAS DataBase Reference | 4009-98-7(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36-24/25 | | RIDADR | UN 1390 4.3/PG 2 | | WGK Germany | 3 | | F | 3-10 | | Hazard Note | Harmful | | HS Code | 29310095 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 |
| | (Methoxymethyl)triphenylphosphonium chloride Usage And Synthesis |
| Chemical Properties | WHITE TO ALMOST WHITE FINE CRYSTALLINE POWDER | | Uses | PTC catalyst | | Uses | (Methoxymethyl)triphenylphosphonium chloride is used as a phase transfer catalyst and in the synthesis of taxol-A fragment. It is widely used in the synthesis of pharmaceutical product cephalotaxine, which is used as an antiviral and antitumor agent. | | Uses | Intermediates of Liquid Crystals | | reaction suitability | reaction type: C-C Bond Formation | | Synthesis | The general procedure for the synthesis of (methoxymethyl)triphenylphosphonium chloride from chloromethyl methyl ether and triphenylphosphine was as follows: 20.0 g of triphenylphosphine was placed in a round-bottomed flask, dissolved in an appropriate amount of toluene, and heated to 95°C. The reaction was carried out at a constant temperature for 16 hours. Subsequently, 6.37 mL of chloromethyl methyl ether was slowly added dropwise and the reaction was kept at temperature for 16 hours. Upon completion of the reaction, the reaction mixture was cooled to room temperature and the solid product was collected by filtration. The filter cake was washed three times with toluene to remove impurities and then dried to give 25.4 g of white phosphonium salt in 97.3% yield. | | References | [1] Synthesis (Germany), 2013, vol. 45, # 5, p. 596 - 600 [2] Patent: CN107936009, 2018, A. Location in patent: Paragraph 0042; 0087-0088 [3] Bulletin of the Chemical Society of Japan, 1980, vol. 53, # 12, p. 3436 - 3438 [4] Patent: CN106588982, 2017, A. Location in patent: Paragraph 0008; 0017; 0018; 0019; 0020; 0021; 0022-0025 [5] Journal of the American Chemical Society, 1976, vol. 98, p. 6613 - 6623 |
| | (Methoxymethyl)triphenylphosphonium chloride Preparation Products And Raw materials |
|