| Company Name: |
Energy Chemical Gold
|
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:Benzene-2,3,4,5,6-d5-methanol
CAS:68661-10-9
Purity:99%，99 atom D% Package:1g
|
| Company Name: |
China Langchem Inc.
|
| Tel: |
021-58956006,021-58950017 15800617331 |
| Email: |
sales@langchem.com |
| Products Intro: |
Product Name:Benzyl alcohol-d5
CAS:68661-10-9
Package:1kg
|
|
| | BENZYL-2,3,4,5,6-D5 ALCOHOL Basic information |
| Product Name: | BENZYL-2,3,4,5,6-D5 ALCOHOL | | Synonyms: | Benzene-2,3,4,5,6-d5-methanol;BENZYL-2,3,4,5,6-D5 ALCOHOL;BENZYL-2,3,4,5,6-D5, ALCOHOL, 98 ATOM % D;Benzene-d5-methanol;(2,3,4,5,6-pentadeuteriophenyl)methanol;Benzyl-2,3,4,5,6-d? alcohol;(Phenyl-d5)methanol;Benzene-2,3,4,5,6-Ds-methanol | | CAS: | 68661-10-9 | | MF: | C7H3D5O | | MW: | 113.17 | | EINECS: | | | Product Categories: | Alphabetical Listings;B;Stable Isotopes | | Mol File: | 68661-10-9.mol |  |
| | BENZYL-2,3,4,5,6-D5 ALCOHOL Chemical Properties |
| Melting point | -16--13 °C(lit.) | | Boiling point | 203-205 °C(lit.) | | density | 1.094 g/mL at 25 °C | | refractive index | n20/D 1.539(lit.) | | Fp | 213 °F | | solubility | Acetone (Slightly) | | form | Liquid | | color | Colourless | | InChI | InChI=1S/C7H8O/c8-6-7-4-2-1-3-5-7/h1-5,8H,6H2/i1D,2D,3D,4D,5D | | InChIKey | WVDDGKGOMKODPV-RALIUCGRSA-N | | SMILES | C(C1C([2H])=C([2H])C([2H])=C([2H])C=1[2H])O |
| Hazard Codes | Xn | | Risk Statements | 20/22 | | Safety Statements | 26 | | RIDADR | UN 3334 | | WGK Germany | 1 |
| | BENZYL-2,3,4,5,6-D5 ALCOHOL Usage And Synthesis |
| Uses | Benzyl-2,3,4,5,6-D5 Alcohol is an isotopically labeled analog of Benzyl Alcohol (T536635), which is used in the synthesis of Cephalosporolide B as a versatile biomimetic synthetic precursor for chemical synthesis of other cephalosporides. |
| | BENZYL-2,3,4,5,6-D5 ALCOHOL Preparation Products And Raw materials |
|