|
|
| | 3-Amino-3-(3,4-dichloro-phenyl)-propionic acid Basic information |
| Product Name: | 3-Amino-3-(3,4-dichloro-phenyl)-propionic acid | | Synonyms: | 3-AMINO-3-(3,4-DICHLOROPHENYL)PROPANOIC ACID;BIO-FARMA BF000148;DL-3-AMINO-3-(3,4-DICHLORO-PHENYL)-PROPIONIC ACID;RARECHEM AK HC T316;VITAS-BB TBB000068;3-(3,4-DICHLOROPHENYL)-BETA-ALANINE;3-(3,4-Dichloro-phenyl)-DL-beta-alanine;4-dichloro-phenyl)-DL-beta-alanine | | CAS: | 117391-57-8 | | MF: | C9H9Cl2NO2 | | MW: | 234.08 | | EINECS: | | | Product Categories: | B-Amino | | Mol File: | 117391-57-8.mol |  |
| | 3-Amino-3-(3,4-dichloro-phenyl)-propionic acid Chemical Properties |
| Melting point | 224-226°C | | Boiling point | 371.9±42.0 °C(Predicted) | | density | 1.447±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | 3.54±0.10(Predicted) | | form | solid | | InChI | 1S/C9H9Cl2NO2/c10-6-2-1-5(3-7(6)11)8(12)4-9(13)14/h1-3,8H,4,12H2,(H,13,14) | | InChIKey | ACJWNKAQMZQVBW-UHFFFAOYSA-N | | SMILES | NC(CC(O)=O)C(C=C1)=CC(Cl)=C1Cl | | CAS DataBase Reference | 117391-57-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-Amino-3-(3,4-dichloro-phenyl)-propionic acid Usage And Synthesis |
| | 3-Amino-3-(3,4-dichloro-phenyl)-propionic acid Preparation Products And Raw materials |
|