| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | Bis(4-nitrophenyl) phosphate hydrate Basic information |
| | Bis(4-nitrophenyl) phosphate hydrate Chemical Properties |
| Melting point | 171-174 °C | | storage temp. | 2-8°C | | form | powder | | BRN | 2064857 | | InChI | 1S/C12H9N2O8P.H2O/c15-13(16)9-1-5-11(6-2-9)21-23(19,20)22-12-7-3-10(4-8-12)14(17)18;/h1-8H,(H,19,20);1H2 | | InChIKey | AJCYEUQRBLMJDI-UHFFFAOYSA-N | | SMILES | O.OP(=O)(Oc1ccc(cc1)[N+]([O-])=O)Oc2ccc(cc2)[N+]([O-])=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | Storage Class | 13 - Non Combustible Solids |
| | Bis(4-nitrophenyl) phosphate hydrate Usage And Synthesis |
| Uses | The hydrolysis of Bis(4-nitrophenyl) phosphate hydrate was studied. | | General Description | The hydrolysis of Bis(4-nitrophenyl) phosphate hydrate was studied. |
| | Bis(4-nitrophenyl) phosphate hydrate Preparation Products And Raw materials |
|