|
|
| | 4-(1H-1,2,4-TRIAZOL-1-YL)BENZOIC ACID Basic information |
| | 4-(1H-1,2,4-TRIAZOL-1-YL)BENZOIC ACID Chemical Properties |
| Melting point | 318 °C | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | color | Off-white | | InChI | InChI=1S/C9H7N3O2/c13-9(14)7-1-3-8(4-2-7)12-6-10-5-11-12/h1-6H,(H,13,14) | | InChIKey | FOMQQGKCPYKKHQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(N2C=NC=N2)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36 | | Hazard Note | Irritant | | HS Code | 2916399090 |
| | 4-(1H-1,2,4-TRIAZOL-1-YL)BENZOIC ACID Usage And Synthesis |
| | 4-(1H-1,2,4-TRIAZOL-1-YL)BENZOIC ACID Preparation Products And Raw materials |
|