TH1834 dihydrochloride manufacturers
|
| | TH1834 dihydrochloride Basic information |
| Product Name: | TH1834 dihydrochloride | | Synonyms: | TH1834 dihydrochloride;TH1834 dihydrochloride,TH-1834 dihydrochloride;2-[5-(4-{[(2-phenylethyl)({4-[4-(pyrrolidin-1-ylmethyl)phenoxy]butyl})amino]methyl}phenyl)-2H-1,2,3,4-tetrazol-2-yl]acetic acid hydr ochloride | | CAS: | 2108830-09-5 | | MF: | C33H41ClN6O3 | | MW: | 605.18 | | EINECS: | | | Product Categories: | | | Mol File: | 2108830-09-5.mol |  |
| | TH1834 dihydrochloride Chemical Properties |
| storage temp. | -20°C | | solubility | H2O: 2 mg/mL, clear | | form | Solid | | color | White to off-white | | Water Solubility | H2O: 2mg/mL, clear | | InChIKey | HYXIFSOROZPMMU-UHFFFAOYSA-N | | SMILES | O=C(O)CN1N=C(C2=CC=C(CN(CCC3=CC=CC=C3)CCCCOC4=CC=C(CN5CCCC5)C=C4)C=C2)N=N1.[H]Cl.[H]Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | TH1834 dihydrochloride Usage And Synthesis |
| Description | TH1834 HCl is a Tip60 histone acetyltransferase inhibitor. | | Uses | TH1834 dihydrochloride is a specific Tip60 (KAT5) histone acetyltransferase inhibitor. TH1834 dihydrochloride induces apoptosis and increases DNA damage in breast cancer. TH1834 dihydrochloride does not affect the activity of related histone acetyltransferase MOF. Anticancer activity[1]. | | IC 50 | TIP60 | | References | [1] Gao C, et al. Rational design and validation of a Tip60 histone acetyltransferase inhibitor. Sci Rep. 2014 Jun 20;4:5372. DOI:10.1038/srep05372 |
| | TH1834 dihydrochloride Preparation Products And Raw materials |
|