| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:3,5-Dimethylbenzenesulfonyl fluoride
CAS:86146-00-1
Purity:95% (H-NMR) Package:1G Remarks:ALD00206-1G
|
| Company Name: |
Nanjing Shizhou Biology Technology Co.,Ltd
|
| Tel: |
025-025-85560043 17301488900 |
| Email: |
info@synzest.com |
| Products Intro: |
Product Name:3,5-Dimethylbenzenesulfonyl fluoride
CAS:86146-00-1
Purity:95% Package:50mg；100mg
|
| Company Name: |
Nanjing Shizhou Biology Technology Co.,Ltd
|
| Tel: |
13675144456 |
| Email: |
sean.lv@synzest.com |
| Products Intro: |
Product Name:3,5-Dimethylbenzenesulfonyl fluoride
CAS:86146-00-1
Purity:95%HPLC Package:500mg;1g;5g;10g
|
| Company Name: |
Zhuhai Aobokai Biomedical Technology Co., Ltd.
|
| Tel: |
400-0628126 |
| Email: |
sales-team@aobchem.com.cn |
| Products Intro: |
Product Name:3,5-dimethylbenzene-1-sulfonyl fluoride
CAS:86146-00-1
Purity:>=95% Package:1212元/1g Remarks:953728
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:3,5-Dimethylbenzenesulfonyl fluoride
CAS:86146-00-1
|
|
| | 3,5-Dimethylbenzenesulfonyl fluoride Basic information |
| | 3,5-Dimethylbenzenesulfonyl fluoride Chemical Properties |
| Melting point | 35-40°C | | Fp | >110°C | | form | solid | | InChI | 1S/C8H9FO2S/c1-6-3-7(2)5-8(4-6)12(9,10)11/h3-5H,1-2H3 | | InChIKey | USDUCJJANRAWTQ-UHFFFAOYSA-N | | SMILES | CC1=CC(C)=CC(S(F)(=O)=O)=C1 |
| RIDADR | UN 3261 8 / PGII | | WGK Germany | 3 | | HS Code | 2904990090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 3,5-Dimethylbenzenesulfonyl fluoride Usage And Synthesis |
| Uses | Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers. | | reaction suitability | reaction type: click chemistry |
| | 3,5-Dimethylbenzenesulfonyl fluoride Preparation Products And Raw materials |
|