| Company Name: |
chemmole Gold |
| Tel: |
400-168-9330 15013243073 |
| Email: |
597760450@qq.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Fluoroboric acid diethyl ether complex manufacturers
|
| | Fluoroboric acid diethyl ether complex Basic information |
| Product Name: | Fluoroboric acid diethyl ether complex | | Synonyms: | borate(1-),tetrafluoro-,hydrogen,compd.with1,1’-oxybis[ethane](1:1);hydrogen tetrafluoroborate(1-), compound with ethyl ether (1:1);TFBA ET2O;TETRAFLUOROBORIC ACID ETHERATE);Tetrafluoroboric acid-diethyl ether complex, 50-55% w/w HBF4;fluoboric acid/ diethyl ether complex;Tetrafluoroboric acid-diethyl ether complex, 50-55% w/w HBF4;Tetrafluoroboric acid diethyl ether complex, 50 - 55% HBF4 | | CAS: | 67969-82-8 | | MF: | C4H11BF4O | | MW: | 161.93 | | EINECS: | 267-983-8 | | Product Categories: | | | Mol File: | 67969-82-8.mol |  |
| | Fluoroboric acid diethyl ether complex Chemical Properties |
| density | 1.19 g/mL at 20 °C(lit.) | | Fp | −40 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Colorless to pale orange | | Specific Gravity | 1.19 | | Water Solubility | Reacts in water.Miscible with dichloromethane. | | Merck | 14,4149 | | InChI | InChI=1S/C4H10O.BF4/c1-3-5-4-2;2-1(3,4)5/h3-4H2,1-2H3;/q;-1/p+1 | | InChIKey | XFHGDBFMJCLEOW-UHFFFAOYSA-N | | SMILES | O(CC)CC.[B+3]([F-])([F-])([F-])[F-].[H+] | | EPA Substance Registry System | Borate(1-), tetrafluoro-, hydrogen, compd. with 1,1'-oxybis[ethane] (1:1) (67969-82-8) |
| Hazard Codes | F,C | | Risk Statements | 11-14-34 | | Safety Statements | 26-36/37/39-43-45 | | RIDADR | UN 3129 4.3/PG 2 | | WGK Germany | 1 | | F | 3 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | I | | HS Code | 29091990 | | Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B Water-react 2 |
| | Fluoroboric acid diethyl ether complex Usage And Synthesis |
| Uses | Tetrafluoroboric acid diethyl ether complex can be used to facilitate phosphine-borane decomplexation from bisphosphine-borane complexes for the preparation of bisphosphine ligands. It can also act as ligands to synthesize with transition-metal complexes. |
| | Fluoroboric acid diethyl ether complex Preparation Products And Raw materials |
|