|
|
| | Amlodipine Impurity 26 Basic information |
| Product Name: | Amlodipine Impurity 26 | | Synonyms: | Amlodipine Impurity 4;Amlodipine Impurity 57;3,5-Pyridinedicarboxylic acid, 2-(chloromethyl)-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester;Amlodipine Impurity 26;Amlodipine Impurity 102 | | CAS: | 107812-86-2 | | MF: | C18H19Cl2NO4 | | MW: | 384.25 | | EINECS: | | | Product Categories: | | | Mol File: | 107812-86-2.mol |  |
| | Amlodipine Impurity 26 Chemical Properties |
| InChI | InChI=1S/C18H19Cl2NO4/c1-4-25-18(23)16-13(9-19)21-10(2)14(17(22)24-3)15(16)11-7-5-6-8-12(11)20/h5-8,15,21H,4,9H2,1-3H3 | | InChIKey | ZLBUAOXROCJPCF-UHFFFAOYSA-N | | SMILES | C1(CCl)NC(C)=C(C(OC)=O)C(C2=CC=CC=C2Cl)C=1C(OCC)=O |
| | Amlodipine Impurity 26 Usage And Synthesis |
| | Amlodipine Impurity 26 Preparation Products And Raw materials |
|