|
|
| | 4-METHYLPHTHALAZIN-1(2H)-ONE Basic information |
| Product Name: | 4-METHYLPHTHALAZIN-1(2H)-ONE | | Synonyms: | 4-METHYLPHTHALAZIN-1(2H)-ONE;4-METHYL-2H-PHTHALAZIN-1-ONE;AURORA KA-5078;1-Methylphthalazine-4(3H)-one;ICX-56274004;4-methyl-1(2H)-phthalazinone(SALTDATA: FREE);4-Methyl-1-phthalazinol;4-Methyl-1-phthalazinone | | CAS: | 5004-48-8 | | MF: | C9H8N2O | | MW: | 160.17 | | EINECS: | | | Product Categories: | Miscellaneous Reagents | | Mol File: | 5004-48-8.mol |  |
| | 4-METHYLPHTHALAZIN-1(2H)-ONE Chemical Properties |
| Melting point | 223-224°C | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 12.32±0.40(Predicted) | | form | crystalline powder | | color | Pale yellow | | InChI | InChI=1S/C9H8N2O/c1-6-7-4-2-3-5-8(7)9(12)11-10-6/h2-5H,1H3,(H,11,12) | | InChIKey | QRNVHFPDZAZUGX-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(C)=NN1 | | CAS DataBase Reference | 5004-48-8 |
| | 4-METHYLPHTHALAZIN-1(2H)-ONE Usage And Synthesis |
| Chemical Properties | Colourless Cyrstalline Solid | | Uses | Hydroxy-4-methylphthalazine (cas# 5004-48-8) is a compound useful in organic synthesis. |
| | 4-METHYLPHTHALAZIN-1(2H)-ONE Preparation Products And Raw materials |
|