|
|
| | N1,N2-bis(1-naphthalenylmethyl)ethanediamide Basic information |
| Product Name: | N1,N2-bis(1-naphthalenylmethyl)ethanediamide | | Synonyms: | N1,N2-bis(1-naphthalenylmethyl)ethanediamide;Ethanediamide, N1,N2-bis(1-naphthalenylmethyl)-;N1,N2-Bis(naphthalen-1-ylmethyl)oxalamide;N1,N2-Bis(1-naphthylmethyl)oxalamide;N1,N2-bis(1-naphthalenemethyl)ethyldiamide;BNMO | | CAS: | 2281918-10-1 | | MF: | C24H20N2O2 | | MW: | 368.43 | | EINECS: | | | Product Categories: | | | Mol File: | 2281918-10-1.mol |  |
| | N1,N2-bis(1-naphthalenylmethyl)ethanediamide Chemical Properties |
| density | 1.244±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 11.81±0.46(Predicted) | | form | powder | | Appearance | White to off-white Solid | | InChI | InChI=1S/C24H20N2O2/c27-23(25-15-19-11-5-9-17-7-1-3-13-21(17)19)24(28)26-16-20-12-6-10-18-8-2-4-14-22(18)20/h1-14H,15-16H2,(H,25,27)(H,26,28) | | InChIKey | UJFILYKONHUVCH-UHFFFAOYSA-N | | SMILES | C(NCC1=C2C(C=CC=C2)=CC=C1)(=O)C(NCC1=C2C(C=CC=C2)=CC=C1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | N1,N2-bis(1-naphthalenylmethyl)ethanediamide Usage And Synthesis |
| Uses | BNMO is a ligand for the copper-catalyzed coupling of aryl halides and alkyl alcohols. |
| | N1,N2-bis(1-naphthalenylmethyl)ethanediamide Preparation Products And Raw materials |
|