| Company Name: |
HongShengBY Gold |
| Tel: |
15809295147 |
| Email: |
3809685182@qq.com |
4,4',4'',4'''-(1,4-phenylenebis(azanetriyl))tetrabenzoic acid manufacturers
|
| | 4,4',4'',4'''-(1,4-phenylenebis(azanetriyl))tetrabenzoic acid Basic information |
| Product Name: | 4,4',4'',4'''-(1,4-phenylenebis(azanetriyl))tetrabenzoic acid | | Synonyms: | 4,4',4'',4'''-(1,4-phenylenebis(azanetriyl))tetrabenzoic acid;Benzoic acid, 4,4',4'',4'''-(1,4-phenylenedinitrilo)tetrakis-;4,4',4'',4'''-(1,4-phenylenedinitrilo)tetrakis-Benzoic acid;Benzoic acid, 4,4',4'',4'''-(1,4-phenylenedinitrilo)tetrakis- (9CI);N,N,N',N'-tetrakis(4-carboxyphenyl)-1,4-phenylenediamine;4,4 ', 4' ', 4' '- (1,4-phenylenebis (azatriyl)) tetrabenzoic acid;N,N,N',N'-tetrakis(4-carboxyphenyl)-1,4-phenylenediamine;4,4',4'',4'''-(1,4-isophenylbis(azatriyl))tetrabenzenemacetic acid | | CAS: | 873655-81-3 | | MF: | C34H24N2O8 | | MW: | 588.56 | | EINECS: | | | Product Categories: | | | Mol File: | 873655-81-3.mol |  |
| | 4,4',4'',4'''-(1,4-phenylenebis(azanetriyl))tetrabenzoic acid Chemical Properties |
| Boiling point | 898.9±65.0 °C(Predicted) | | density | 1.464±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.72±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChIKey | UBNQFWCYYJTPNA-UHFFFAOYSA-N | | SMILES | C1(N(C2=CC=C(C=C2)C(O)=O)C2=CC=C(C=C2)C(O)=O)=CC=C(N(C2=CC=C(C=C2)C(O)=O)C2=CC=C(C=C2)C(O)=O)C=C1 |
| | 4,4',4'',4'''-(1,4-phenylenebis(azanetriyl))tetrabenzoic acid Usage And Synthesis |
| Uses | Used as a ligand in the synthesis of MOF materials: [Cu2(D2-tcppda)(H2O)2]·; Polyamide. |
| | 4,4',4'',4'''-(1,4-phenylenebis(azanetriyl))tetrabenzoic acid Preparation Products And Raw materials |
|