|
|
| | 2-(tert-Butoxycarbonyl-methyl-amino)-benzoic acid Basic information |
| | 2-(tert-Butoxycarbonyl-methyl-amino)-benzoic acid Chemical Properties |
| Boiling point | 367.0±25.0 °C(Predicted) | | density | 1.199±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.68±0.36(Predicted) | | InChI | 1S/C13H17NO4/c1-13(2,3)18-12(17)14(4)10-8-6-5-7-9(10)11(15)16/h5-8H,1-4H3,(H,15,16) | | InChIKey | UXLICAHPTWWCII-UHFFFAOYSA-N | | SMILES | N(C)(c1c(cccc1)C(=O)O)C(=O)OC(C)(C)C |
| WGK Germany | WGK 3 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | 2-(tert-Butoxycarbonyl-methyl-amino)-benzoic acid Usage And Synthesis |
| Chemical Properties | Off-white solid |
| | 2-(tert-Butoxycarbonyl-methyl-amino)-benzoic acid Preparation Products And Raw materials |
|