|
|
| | 4,4'-(1,3-ADAMANTANEDIYL)DIPHENOL Basic information |
| Product Name: | 4,4'-(1,3-ADAMANTANEDIYL)DIPHENOL | | Synonyms: | 4-[3-(4-hydroxyphenyl)-1-adamantyl]phenol;4,4'-(1,3-ADAMANTANEDIYL)DIPHENOL;4,4'-(1,3-AdaMantanediyl)bisphenol;1,3-Bis(4-Hydroxyphenyl)AdaMantane;1,3-Bis(p-hydroxyphenyl)adamantane;Adamantate;Phenol, 4,4'-tricyclo[3.3.1.13,7]decane-1,3-diylbis-;4,4'-(1,3-Adamantanediyl)diphenol 98% | | CAS: | 37677-93-3 | | MF: | C22H24O2 | | MW: | 320.42 | | EINECS: | | | Product Categories: | Alicyclic/Etch-Resistant Monomers;Lithography Monomers;Self Assembly&Contact Printing | | Mol File: | 37677-93-3.mol |  |
| | 4,4'-(1,3-ADAMANTANEDIYL)DIPHENOL Chemical Properties |
| Melting point | 200-202 °C (lit.) | | InChI | 1S/C22H24O2/c23-19-5-1-17(2-6-19)21-10-15-9-16(11-21)13-22(12-15,14-21)18-3-7-20(24)8-4-18/h1-8,15-16,23-24H,9-14H2/t15-,16+,21+,22- | | InChIKey | DNLWYVQYADCTEU-WGKKAQPQSA-N | | SMILES | Oc1ccc(cc1)C23C[C@H]4C[C@@H](C2)CC(C4)(C3)c5ccc(O)cc5 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 4,4'-(1,3-ADAMANTANEDIYL)DIPHENOL Usage And Synthesis |
| | 4,4'-(1,3-ADAMANTANEDIYL)DIPHENOL Preparation Products And Raw materials |
|