| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 2-(4-Isothiocyanatophenoxy)ethyl tosylat Basic information |
| | 2-(4-Isothiocyanatophenoxy)ethyl tosylat Chemical Properties |
| Melting point | 108-112 °C | | Boiling point | 538.3±40.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | InChI | 1S/C16H15NO4S2/c1-13-2-8-16(9-3-13)23(18,19)21-11-10-20-15-6-4-14(5-7-15)17-12-22/h2-9H,10-11H2,1H3 | | InChIKey | LILJDLJORCAIDG-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)S(=O)(=O)OCCOc2ccc(cc2)N=C=S |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 4
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-(4-Isothiocyanatophenoxy)ethyl tosylat Usage And Synthesis |
| Uses | Hetero-bifunctional linker specially for the quaternisation of pyridyl-nitrogen in order to introduce an amine or thiol reactive group. Synthetic building block for the preparation of fluorescent labels1 |
| | 2-(4-Isothiocyanatophenoxy)ethyl tosylat Preparation Products And Raw materials |
|