(S S)-ethylenediamine-n N-disuccinic aci manufacturers
|
| | (S S)-ethylenediamine-n N-disuccinic aci Basic information |
| Product Name: | (S S)-ethylenediamine-n N-disuccinic aci | | Synonyms: | trisodium [S,S]-ethylene diamine dicussinate;L-Aspartic acid, N,N-1,2-ethanediylbis-, trisodium salt;(s,s)-edds-na3;(s,s)-ethylenediamine-n,n'-disuccinic acid trisodium salt solution;(S,S)-EDDS-Na3, N,Nμ-Ethylenedi-(L-aspartic acid) trisodium salt;(S,S)-Ethylenediamine-N,Nμ-disuccinic acid solution trisodium salt;L-Aspartic acid, N,N'-1,2-ethanediylbis-, sodium salt (1:3);Trisodium (S,S)-ethylenediamine-N,N′-disuccinate | | CAS: | 178949-82-1 | | MF: | C10H17N2NaO8 | | MW: | 316.24 | | EINECS: | 416-530-4 | | Product Categories: | | | Mol File: | 178949-82-1.mol |  |
| | (S S)-ethylenediamine-n N-disuccinic aci Chemical Properties |
| density | 1.63[at 20℃] | | vapor pressure | 1.9Pa at 25℃ | | refractive index | n20/D 1.416 | | solubility | 0.4 in mg/100g standard fat at 20 ℃ | | pka | 7.5[at 20 ℃] | | Water Solubility | 1000g/L at 20℃ | | Cosmetics Ingredients Functions | CHELATING | | InChI | InChI=1/C10H16N2O8.Na.H/c13-7(14)3-5(9(17)18)11-1-2-12-6(10(19)20)4-8(15)16;;/h5-6,11-12H,1-4H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/t5-,6-;;/s3 | | InChIKey | PSZPADUSRPBAGJ-CAZAILOXNA-N | | SMILES | [C@@H](NCCN[C@H](C(=O)O)CC(=O)O)(C(=O)O)CC(=O)O.[NaH] |&1:0,5,r| | | LogP | -4.7 at 20℃ | | EPA Substance Registry System | L-Aspartic acid, N,N'-1,2-ethanediylbis-, trisodium salt (178949-82-1) |
| WGK Germany | 3 | | TSCA | TSCA listed |
| | (S S)-ethylenediamine-n N-disuccinic aci Usage And Synthesis |
| Uses | (2S,2''S)-2,2''-(Ethane-1,2-diylbis(azanediyl))disuccinic Acid functions as a chelant used in improving hair health and in preventing free radical formations. It is also used in the making of anti-snoring compositions. A chelants that enhances metal translocation in plants. | | Flammability and Explosibility | Not classified |
| | (S S)-ethylenediamine-n N-disuccinic aci Preparation Products And Raw materials |
|