| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 2-(3-Aminophenylsulfonyl)ethanol Basic information |
| | 2-(3-Aminophenylsulfonyl)ethanol Chemical Properties |
| Melting point | 210 °C (dec.)(lit.) | | storage temp. | room temp | | form | powder or crystals | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C8H11NO3S.ClH/c9-7-2-1-3-8(6-7)13(11,12)5-4-10;/h1-3,6,10H,4-5,9H2;1H | | InChIKey | VTZPDMOWNKSUSG-UHFFFAOYSA-N | | SMILES | Cl.Nc1cccc(c1)S(=O)(=O)CCO |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-(3-Aminophenylsulfonyl)ethanol Usage And Synthesis |
| Uses | diagnostic assay manufacturing hematology histology |
| | 2-(3-Aminophenylsulfonyl)ethanol Preparation Products And Raw materials |
|