|
|
| | Mesityl-d10 oxide, 98 atom % D Basic information |
| | Mesityl-d10 oxide, 98 atom % D Chemical Properties |
| Melting point | −53 °C(lit.) | | Boiling point | 129 °C(lit.) | | density | 0.946 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.443(lit.) | | Fp | 31 °C | | InChI | 1S/C6H10O/c1-5(2)4-6(3)7/h4H,1-3H3/i1D3,2D3,3D3,4D | | InChIKey | SHOJXDKTYKFBRD-LSURFNHSSA-N | | SMILES | [2H]\C(C(=O)C([2H])([2H])[2H])=C(/C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Hazard Codes | Xn | | Risk Statements | 10-20/21/22-37/38-41 | | Safety Statements | 16-26-33-36/37/39 | | RIDADR | UN 1229 3/PG 3 | | WGK Germany | WGK 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Flam. Liq. 3 |
| | Mesityl-d10 oxide, 98 atom % D Usage And Synthesis |
| Uses | Mesityl Oxide-d10 is the labelled form of Mesityl Oxide, a α,β-unsaturated ketone, and has a strong peppermint odor. It is mainly used as a solvent and in the production of methyl isobutyl ketone by hydrogenation. |
| | Mesityl-d10 oxide, 98 atom % D Preparation Products And Raw materials |
|